C24H34CuN2O4 — CID 11496596
acetic acid;copper;2-[[[(1S,2S)-2-[(2-hydroxyphenyl)methyl-methylamino]cyclohexyl]-methylamino]methyl]phenol (PubChem CID 11496596) has the molecular formula C24H34CuN2O4 and a molecular weight of 478.09 g/mol. Its IUPAC name is acetic acid;copper;2-[[[(1S,2S)-2-[(2-hydroxyphenyl)methyl-methylamino]cyclohexyl]-methylamino]methyl]phenol.
| Compound Name | acetic acid;copper;2-[[[(1S,2S)-2-[(2-hydroxyphenyl)methyl-methylamino]cyclohexyl]-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 11496596 |
| Molecular Formula | C24H34CuN2O4 |
| Molecular Weight | 478.09 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | acetic acid;copper;2-[[[(1S,2S)-2-[(2-hydroxyphenyl)methyl-methylamino]cyclohexyl]-methylamino]methyl]phenol |
| SMILES | CC(=O)O.CN(Cc1ccccc1O)[C@H]1CCCC[C@@H]1N(C)Cc1ccccc1O.[Cu] |
| InChI | InChI=1S/C22H30N2O2.C2H4O2.Cu/c1-23(15-17-9-3-7-13-21(17)25)19-11-5-6-12-20(19)24(2)16-18-10-4-8-14-22(18)26;1-2(3)4;/h3-4,7-10,13-14,19-20,25-26H,5-6,11-12,15-16H2,1-2H3;1H3,(H,3,4);/t19-,20-;;/m0../s1 |
| InChIKey | PSRYNJWRBKCSPV-TULUPMBKSA-N |
| XLogP | 4.06 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|