C16H17NO3 — CID 88774811
N,N-bis[(2-hydroxyphenyl)methyl]acetamide (PubChem CID 88774811) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N,N-bis[(2-hydroxyphenyl)methyl]acetamide.
| Compound Name | N,N-bis[(2-hydroxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 88774811 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N,N-bis[(2-hydroxyphenyl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1O)Cc1ccccc1O |
| InChI | InChI=1S/C16H17NO3/c1-12(18)17(10-13-6-2-4-8-15(13)19)11-14-7-3-5-9-16(14)20/h2-9,19-20H,10-11H2,1H3 |
| InChIKey | IZLSKNSUJGFDIW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|