C25H22N2O2S3 — CID 11496649
3,5-bis(benzylsulfanyl)-N-(4-methoxyphenyl)-1,2-thiazole-4-carboxamide (PubChem CID 11496649) has the molecular formula C25H22N2O2S3 and a molecular weight of 478.66 g/mol. Its IUPAC name is 3,5-bis(benzylsulfanyl)-N-(4-methoxyphenyl)-1,2-thiazole-4-carboxamide.
| Compound Name | 3,5-bis(benzylsulfanyl)-N-(4-methoxyphenyl)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 11496649 |
| Molecular Formula | C25H22N2O2S3 |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 3,5-bis(benzylsulfanyl)-N-(4-methoxyphenyl)-1,2-thiazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(SCc3ccccc3)nsc2SCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O2S3/c1-29-21-14-12-20(13-15-21)26-23(28)22-24(30-16-18-8-4-2-5-9-18)27-32-25(22)31-17-19-10-6-3-7-11-19/h2-15H,16-17H2,1H3,(H,26,28) |
| InChIKey | RGVJOCWSGHPKPH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |