C18H28O — CID 114968742
3,7-dimethyl-4-phenyldecan-5-one (PubChem CID 114968742) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 3,7-dimethyl-4-phenyldecan-5-one.
| Compound Name | 3,7-dimethyl-4-phenyldecan-5-one |
|---|---|
| PubChem CID | 114968742 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 3,7-dimethyl-4-phenyldecan-5-one |
| SMILES | CCCC(C)CC(=O)C(c1ccccc1)C(C)CC |
| InChI | InChI=1S/C18H28O/c1-5-10-14(3)13-17(19)18(15(4)6-2)16-11-8-7-9-12-16/h7-9,11-12,14-15,18H,5-6,10,13H2,1-4H3 |
| InChIKey | XBVFBOSFBIASKX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |