C14H13BrOS — CID 114969742
2-(3-bromothiophen-2-yl)-1-(2,3-dimethylphenyl)ethanone (PubChem CID 114969742) has the molecular formula C14H13BrOS and a molecular weight of 309.23 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(2,3-dimethylphenyl)ethanone.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 114969742 |
| Molecular Formula | C14H13BrOS |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(2,3-dimethylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)Cc2sccc2Br)c1C |
| InChI | InChI=1S/C14H13BrOS/c1-9-4-3-5-11(10(9)2)13(16)8-14-12(15)6-7-17-14/h3-7H,8H2,1-2H3 |
| InChIKey | RTKHJUIDOCMTCV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |