C16H24O4 — CID 114970019
4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-one (PubChem CID 114970019) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-one.
| Compound Name | 4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 114970019 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4,4-dimethyl-1-(2,4,5-trimethoxyphenyl)pentan-1-one |
| SMILES | COc1cc(OC)c(C(=O)CCC(C)(C)C)cc1OC |
| InChI | InChI=1S/C16H24O4/c1-16(2,3)8-7-12(17)11-9-14(19-5)15(20-6)10-13(11)18-4/h9-10H,7-8H2,1-6H3 |
| InChIKey | RMOSNZNCVWCMON-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |