C15H22O6 — CID 173266476
2,2-dimethylpropyl 2,4,5-trimethoxybenzenecarboperoxoate (PubChem CID 173266476) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2,4,5-trimethoxybenzenecarboperoxoate.
| Compound Name | 2,2-dimethylpropyl 2,4,5-trimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266476 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2,2-dimethylpropyl 2,4,5-trimethoxybenzenecarboperoxoate |
| SMILES | COc1cc(OC)c(C(=O)OOCC(C)(C)C)cc1OC |
| InChI | InChI=1S/C15H22O6/c1-15(2,3)9-20-21-14(16)10-7-12(18-5)13(19-6)8-11(10)17-4/h7-8H,9H2,1-6H3 |
| InChIKey | DFPOOPPOSGRTSN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|