About 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one
1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one (PubChem CID 114970099) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one.
Molecular Properties
| Compound Name | 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one |
| PubChem CID | 114970099 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C17H26O/c1-16(2,3)12-11-15(18)13-9-7-8-10-14(13)17(4,5)6/h7-10H,11-12H2,1-6H3 |
| InChIKey | CLBZGQJQRCZWCI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one?
The IUPAC name of 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one (CID 114970099) is 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one.
What is the SMILES notation for 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one?
The canonical SMILES for 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one is CC(C)(C)CCC(=O)c1ccccc1C(C)(C)C.
What is the InChIKey of 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one?
The InChIKey is CLBZGQJQRCZWCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O/c1-16(2,3)12-11-15(18)13-9-7-8-10-14(13)17(4,5)6/h7-10H,11-12H2,1-6H3.
What are the key properties of 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one?
1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one has a molecular weight of 246.39 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butylphenyl)-4,4-dimethylpentan-1-one is sourced from PubChem (CID 114970099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).