C16H24O — CID 23071301
1-(2-tert-butylphenyl)-3,3-dimethylbutan-1-one (PubChem CID 23071301) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(2-tert-butylphenyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 23071301 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-(2-tert-butylphenyl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C16H24O/c1-15(2,3)11-14(17)12-9-7-8-10-13(12)16(4,5)6/h7-10H,11H2,1-6H3 |
| InChIKey | LVRPOXOXSAHUCA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |