C15H12F3NO — CID 114971487
1-(6-methyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 114971487) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-(6-methyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(6-methyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 114971487 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1-(6-methyl-3-pyridinyl)-2-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | Cc1ccc(C(=O)Cc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C15H12F3NO/c1-10-2-5-12(9-19-10)14(20)8-11-3-6-13(7-4-11)15(16,17)18/h2-7,9H,8H2,1H3 |
| InChIKey | WPTYPHYLJPBACL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |