C14H17BrO2 — CID 114976829
1-(2-bromo-5-methylphenyl)-3-(oxolan-2-yl)propan-1-one (PubChem CID 114976829) has the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. Its IUPAC name is 1-(2-bromo-5-methylphenyl)-3-(oxolan-2-yl)propan-1-one.
| Compound Name | 1-(2-bromo-5-methylphenyl)-3-(oxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 114976829 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-(2-bromo-5-methylphenyl)-3-(oxolan-2-yl)propan-1-one |
| SMILES | Cc1ccc(Br)c(C(=O)CCC2CCCO2)c1 |
| InChI | InChI=1S/C14H17BrO2/c1-10-4-6-13(15)12(9-10)14(16)7-5-11-3-2-8-17-11/h4,6,9,11H,2-3,5,7-8H2,1H3 |
| InChIKey | WLYVTHGCLYPRTO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |