C15H18Br2O2 — CID 81473361
1-(2,5-dibromo-4-methylphenyl)-3-(oxan-2-yl)propan-1-one (PubChem CID 81473361) has the molecular formula C15H18Br2O2 and a molecular weight of 390.12 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-methylphenyl)-3-(oxan-2-yl)propan-1-one.
| Compound Name | 1-(2,5-dibromo-4-methylphenyl)-3-(oxan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 81473361 |
| Molecular Formula | C15H18Br2O2 |
| Molecular Weight | 390.12 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 1-(2,5-dibromo-4-methylphenyl)-3-(oxan-2-yl)propan-1-one |
| SMILES | Cc1cc(Br)c(C(=O)CCC2CCCCO2)cc1Br |
| InChI | InChI=1S/C15H18Br2O2/c1-10-8-14(17)12(9-13(10)16)15(18)6-5-11-4-2-3-7-19-11/h8-9,11H,2-7H2,1H3 |
| InChIKey | ZXSPZWZPNPTQBU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.12 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |