C16H22O3 — CID 114965567
1-(4-methoxy-2-methylphenyl)-3-(oxan-2-yl)propan-1-one (PubChem CID 114965567) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(4-methoxy-2-methylphenyl)-3-(oxan-2-yl)propan-1-one.
| Compound Name | 1-(4-methoxy-2-methylphenyl)-3-(oxan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 114965567 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-(4-methoxy-2-methylphenyl)-3-(oxan-2-yl)propan-1-one |
| SMILES | COc1ccc(C(=O)CCC2CCCCO2)c(C)c1 |
| InChI | InChI=1S/C16H22O3/c1-12-11-14(18-2)6-8-15(12)16(17)9-7-13-5-3-4-10-19-13/h6,8,11,13H,3-5,7,9-10H2,1-2H3 |
| InChIKey | OPTOKLKLMUFYTK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |