C12H10INOS — CID 114979460
1-(4-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone (PubChem CID 114979460) has the molecular formula C12H10INOS and a molecular weight of 343.19 g/mol. Its IUPAC name is 1-(4-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-(4-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 114979460 |
| Molecular Formula | C12H10INOS |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 1-(4-iodophenyl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
| SMILES | Cc1nc(CC(=O)c2ccc(I)cc2)cs1 |
| InChI | InChI=1S/C12H10INOS/c1-8-14-11(7-16-8)6-12(15)9-2-4-10(13)5-3-9/h2-5,7H,6H2,1H3 |
| InChIKey | JWUFFGRPGSCZSF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|