C14H13BrCl2N2O — CID 114980376
1-(5-bromo-2-chlorophenyl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethanone (PubChem CID 114980376) has the molecular formula C14H13BrCl2N2O and a molecular weight of 376.08 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethanone.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 114980376 |
| Molecular Formula | C14H13BrCl2N2O |
| Molecular Weight | 376.08 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)ethanone |
| SMILES | CCc1nn(C)c(CC(=O)c2cc(Br)ccc2Cl)c1Cl |
| InChI | InChI=1S/C14H13BrCl2N2O/c1-3-11-14(17)12(19(2)18-11)7-13(20)9-6-8(15)4-5-10(9)16/h4-6H,3,7H2,1-2H3 |
| InChIKey | SWWYZJOCZHZWFH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.08 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |