C14H13Br2ClN2O — CID 114978090
1-(3-bromo-2-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone (PubChem CID 114978090) has the molecular formula C14H13Br2ClN2O and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-(3-bromo-2-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone.
| Compound Name | 1-(3-bromo-2-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 114978090 |
| Molecular Formula | C14H13Br2ClN2O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 417.91 |
| IUPAC Name | 1-(3-bromo-2-chlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone |
| SMILES | CCc1nn(C)c(CC(=O)c2cccc(Br)c2Cl)c1Br |
| InChI | InChI=1S/C14H13Br2ClN2O/c1-3-10-13(16)11(19(2)18-10)7-12(20)8-5-4-6-9(15)14(8)17/h4-6H,3,7H2,1-2H3 |
| InChIKey | FAZONGFUFXQRRP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |