C14H14BrCl2N3O — CID 116609952
1-(4-amino-3,5-dichlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone (PubChem CID 116609952) has the molecular formula C14H14BrCl2N3O and a molecular weight of 391.10 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 116609952 |
| Molecular Formula | C14H14BrCl2N3O |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)ethanone |
| SMILES | CCc1nn(C)c(CC(=O)c2cc(Cl)c(N)c(Cl)c2)c1Br |
| InChI | InChI=1S/C14H14BrCl2N3O/c1-3-10-13(15)11(20(2)19-10)6-12(21)7-4-8(16)14(18)9(17)5-7/h4-5H,3,6,18H2,1-2H3 |
| InChIKey | CTAUAPYVVPEOHX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|