C13H15ClN2O2S — CID 114980597
2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(3-methoxythiophen-2-yl)ethanone (PubChem CID 114980597) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(3-methoxythiophen-2-yl)ethanone.
| Compound Name | 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(3-methoxythiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 114980597 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(3-methoxythiophen-2-yl)ethanone |
| SMILES | CCn1nc(C)c(Cl)c1CC(=O)c1sccc1OC |
| InChI | InChI=1S/C13H15ClN2O2S/c1-4-16-9(12(14)8(2)15-16)7-10(17)13-11(18-3)5-6-19-13/h5-6H,4,7H2,1-3H3 |
| InChIKey | UXPZHVPZSVVCBK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |