C13H10Cl2O2S — CID 81122836
2-(3,4-dichlorophenyl)-1-(3-methoxythiophen-2-yl)ethanone (PubChem CID 81122836) has the molecular formula C13H10Cl2O2S and a molecular weight of 301.19 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(3-methoxythiophen-2-yl)ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(3-methoxythiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 81122836 |
| Molecular Formula | C13H10Cl2O2S |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(3-methoxythiophen-2-yl)ethanone |
| SMILES | COc1ccsc1C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2O2S/c1-17-12-4-5-18-13(12)11(16)7-8-2-3-9(14)10(15)6-8/h2-6H,7H2,1H3 |
| InChIKey | AMQBNHGKNYSJME-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |