C26H28ClF7N8 — CID 11498196
6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-(2-methylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 11498196) has the molecular formula C26H28ClF7N8 and a molecular weight of 621.01 g/mol. Its IUPAC name is 6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-(2-methylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11498196 |
| Molecular Formula | C26H28ClF7N8 |
| Molecular Weight | 621.01 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 6-[(2R)-4-(3-chloro-2-pyridinyl)-2-methylpiperazin-1-yl]-2-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-N-(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CNc1nc(Nc2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)nc(N2CCN(c3ncccc3Cl)C[C@H]2C)n1 |
| InChI | InChI=1S/C26H28ClF7N8/c1-15(2)13-36-21-38-22(37-18-8-6-17(7-9-18)24(28,25(29,30)31)26(32,33)34)40-23(39-21)42-12-11-41(14-16(42)3)20-19(27)5-4-10-35-20/h4-10,15-16H,11-14H2,1-3H3,(H2,36,37,38,39,40)/t16-/m1/s1 |
| InChIKey | RGTGSSJQIRCRGG-MRXNPFEDSA-N |
| XLogP | 6.74 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.01 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |