C12H21NO — CID 114982292
N-methyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine (PubChem CID 114982292) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-methyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine.
| Compound Name | N-methyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 114982292 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-methyl-1-(2,4,5-trimethylfuran-3-yl)butan-1-amine |
| SMILES | CCCC(NC)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C12H21NO/c1-6-7-11(13-5)12-8(2)9(3)14-10(12)4/h11,13H,6-7H2,1-5H3 |
| InChIKey | YDIVAGBXVOKMSP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |