C19H35NO — CID 115835826
N-propyl-1-(2,4,5-trimethylfuran-3-yl)nonan-1-amine (PubChem CID 115835826) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is N-propyl-1-(2,4,5-trimethylfuran-3-yl)nonan-1-amine.
| Compound Name | N-propyl-1-(2,4,5-trimethylfuran-3-yl)nonan-1-amine |
|---|---|
| PubChem CID | 115835826 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | N-propyl-1-(2,4,5-trimethylfuran-3-yl)nonan-1-amine |
| SMILES | CCCCCCCCC(NCCC)c1c(C)oc(C)c1C |
| InChI | InChI=1S/C19H35NO/c1-6-8-9-10-11-12-13-18(20-14-7-2)19-15(3)16(4)21-17(19)5/h18,20H,6-14H2,1-5H3 |
| InChIKey | RMZVKKHCMMZPDL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|