C11H19F3O3S — CID 114983873
3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol (PubChem CID 114983873) has the molecular formula C11H19F3O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol.
| Compound Name | 3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol |
|---|---|
| PubChem CID | 114983873 |
| Molecular Formula | C11H19F3O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol |
| SMILES | CS(=O)(=O)CCC(O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3O3S/c1-18(16,17)7-6-10(15)8-2-4-9(5-3-8)11(12,13)14/h8-10,15H,2-7H2,1H3 |
| InChIKey | KGUIYUDLKMZNOX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |