C12H16O5S — CID 114983891
1-(2,3-dimethoxyphenyl)-3-methylsulfonylpropan-1-one (PubChem CID 114983891) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-methylsulfonylpropan-1-one.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 114983891 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-methylsulfonylpropan-1-one |
| SMILES | COc1cccc(C(=O)CCS(C)(=O)=O)c1OC |
| InChI | InChI=1S/C12H16O5S/c1-16-11-6-4-5-9(12(11)17-2)10(13)7-8-18(3,14)15/h4-6H,7-8H2,1-3H3 |
| InChIKey | LGWLHVTUQZQEBB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |