C17H27NO2 — CID 114984422
1-(3,4-dihydro-1H-isochromen-1-yl)-5-ethoxy-N-methylpentan-2-amine (PubChem CID 114984422) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-yl)-5-ethoxy-N-methylpentan-2-amine.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-yl)-5-ethoxy-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 114984422 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-yl)-5-ethoxy-N-methylpentan-2-amine |
| SMILES | CCOCCCC(CC1OCCc2ccccc21)NC |
| InChI | InChI=1S/C17H27NO2/c1-3-19-11-6-8-15(18-2)13-17-16-9-5-4-7-14(16)10-12-20-17/h4-5,7,9,15,17-18H,3,6,8,10-13H2,1-2H3 |
| InChIKey | GZECXTPRHWHTNA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|