C13H20N2O3S — CID 114984739
[1-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylpropyl]hydrazine (PubChem CID 114984739) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 114984739 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [1-(3,4-dihydro-2H-chromen-4-yl)-3-methylsulfonylpropyl]hydrazine |
| SMILES | CS(=O)(=O)CCC(NN)C1CCOc2ccccc21 |
| InChI | InChI=1S/C13H20N2O3S/c1-19(16,17)9-7-12(15-14)10-6-8-18-13-5-3-2-4-11(10)13/h2-5,10,12,15H,6-9,14H2,1H3 |
| InChIKey | PXCOARUMKBWBCF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|