C15H25N3O2 — CID 114986197
tert-butyl (2S)-2-(3-propan-2-ylimidazol-4-yl)pyrrolidine-1-carboxylate (PubChem CID 114986197) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3-propan-2-ylimidazol-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(3-propan-2-ylimidazol-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 114986197 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | tert-butyl (2S)-2-(3-propan-2-ylimidazol-4-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)n1cncc1[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O2/c1-11(2)18-10-16-9-13(18)12-7-6-8-17(12)14(19)20-15(3,4)5/h9-12H,6-8H2,1-5H3/t12-/m0/s1 |
| InChIKey | ZCNKXSRMCUCVTE-LBPRGKRZSA-N |
| XLogP | 3.54 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |