C15H23N3O2 — CID 114986201
tert-butyl (2S)-2-(3-prop-2-enylimidazol-4-yl)pyrrolidine-1-carboxylate (PubChem CID 114986201) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3-prop-2-enylimidazol-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(3-prop-2-enylimidazol-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 114986201 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | tert-butyl (2S)-2-(3-prop-2-enylimidazol-4-yl)pyrrolidine-1-carboxylate |
| SMILES | C=CCn1cncc1[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N3O2/c1-5-8-17-11-16-10-13(17)12-7-6-9-18(12)14(19)20-15(2,3)4/h5,10-12H,1,6-9H2,2-4H3/t12-/m0/s1 |
| InChIKey | TUHDSHBRMPWVGX-LBPRGKRZSA-N |
| XLogP | 3.14 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|