C14H21N5O2 — CID 114986211
tert-butyl N-[(1S)-1-[3-(1-methylpyrazol-4-yl)imidazol-4-yl]ethyl]carbamate (PubChem CID 114986211) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[3-(1-methylpyrazol-4-yl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[3-(1-methylpyrazol-4-yl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 114986211 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | tert-butyl N-[(1S)-1-[3-(1-methylpyrazol-4-yl)imidazol-4-yl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1cncn1-c1cnn(C)c1 |
| InChI | InChI=1S/C14H21N5O2/c1-10(17-13(20)21-14(2,3)4)12-7-15-9-19(12)11-6-16-18(5)8-11/h6-10H,1-5H3,(H,17,20)/t10-/m0/s1 |
| InChIKey | UKRCCWZYGRMLDV-JTQLQIEISA-N |
| XLogP | 2.19 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |