C11H25N3O — CID 114987350
2-methyl-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine (PubChem CID 114987350) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-methyl-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine.
| Compound Name | 2-methyl-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 114987350 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 2-methyl-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine |
| SMILES | CC(CN)CCNCCN1CCOCC1 |
| InChI | InChI=1S/C11H25N3O/c1-11(10-12)2-3-13-4-5-14-6-8-15-9-7-14/h11,13H,2-10,12H2,1H3 |
| InChIKey | FLGXLDJFRQMVTB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|