C10H10N2OS — CID 114989358
(2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanone (PubChem CID 114989358) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanone.
| Compound Name | (2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 114989358 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-(1H-pyrazol-4-yl)methanone |
| SMILES | Cc1cc(C(=O)c2cn[nH]c2)c(C)s1 |
| InChI | InChI=1S/C10H10N2OS/c1-6-3-9(7(2)14-6)10(13)8-4-11-12-5-8/h3-5H,1-2H3,(H,11,12) |
| InChIKey | NNFOGYYUZAKIML-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |