C10H6F2N2O — CID 114989396
(2,4-difluorophenyl)-(1H-pyrazol-4-yl)methanone (PubChem CID 114989396) has the molecular formula C10H6F2N2O and a molecular weight of 208.17 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(1H-pyrazol-4-yl)methanone.
| Compound Name | (2,4-difluorophenyl)-(1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 114989396 |
| Molecular Formula | C10H6F2N2O |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (2,4-difluorophenyl)-(1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H6F2N2O/c11-7-1-2-8(9(12)3-7)10(15)6-4-13-14-5-6/h1-5H,(H,13,14) |
| InChIKey | BSENMZUWZZMWTR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |