C10H14N2O3 — CID 114989456
2-methyl-2-(2-oxopyrimidin-1-yl)pentanoic acid (PubChem CID 114989456) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-methyl-2-(2-oxopyrimidin-1-yl)pentanoic acid.
| Compound Name | 2-methyl-2-(2-oxopyrimidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 114989456 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-methyl-2-(2-oxopyrimidin-1-yl)pentanoic acid |
| SMILES | CCCC(C)(C(=O)O)n1cccnc1=O |
| InChI | InChI=1S/C10H14N2O3/c1-3-5-10(2,8(13)14)12-7-4-6-11-9(12)15/h4,6-7H,3,5H2,1-2H3,(H,13,14) |
| InChIKey | IYLVZYJHEIFPTO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |