C13H21N3O4 — CID 142635086
(2S)-4-methyl-2-[methyl(2H-pyrimidin-1-ylmethoxycarbonyl)amino]pentanoic acid (PubChem CID 142635086) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2S)-4-methyl-2-[methyl(2H-pyrimidin-1-ylmethoxycarbonyl)amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[methyl(2H-pyrimidin-1-ylmethoxycarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 142635086 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (2S)-4-methyl-2-[methyl(2H-pyrimidin-1-ylmethoxycarbonyl)amino]pentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)C(=O)OCN1C=CC=NC1 |
| InChI | InChI=1S/C13H21N3O4/c1-10(2)7-11(12(17)18)15(3)13(19)20-9-16-6-4-5-14-8-16/h4-6,10-11H,7-9H2,1-3H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | YSFPLNJMIREPCL-NSHDSACASA-N |
| XLogP | 1.37 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |