C12H18N2O3 — CID 114990602
2,5-dimethyl-2-(2-oxopyrimidin-1-yl)hexanoic acid (PubChem CID 114990602) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2,5-dimethyl-2-(2-oxopyrimidin-1-yl)hexanoic acid.
| Compound Name | 2,5-dimethyl-2-(2-oxopyrimidin-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 114990602 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2,5-dimethyl-2-(2-oxopyrimidin-1-yl)hexanoic acid |
| SMILES | CC(C)CCC(C)(C(=O)O)n1cccnc1=O |
| InChI | InChI=1S/C12H18N2O3/c1-9(2)5-6-12(3,10(15)16)14-8-4-7-13-11(14)17/h4,7-9H,5-6H2,1-3H3,(H,15,16) |
| InChIKey | RYXHKWMNQAJHKV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |