C17H29N — CID 114989797
2,4,4-trimethyl-N-(1-phenylpropan-2-yl)pentan-2-amine (PubChem CID 114989797) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-(1-phenylpropan-2-yl)pentan-2-amine.
| Compound Name | 2,4,4-trimethyl-N-(1-phenylpropan-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 114989797 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 2,4,4-trimethyl-N-(1-phenylpropan-2-yl)pentan-2-amine |
| SMILES | CC(Cc1ccccc1)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H29N/c1-14(12-15-10-8-7-9-11-15)18-17(5,6)13-16(2,3)4/h7-11,14,18H,12-13H2,1-6H3 |
| InChIKey | WGMRDYYKLATRFT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |