C12H12F2O3 — CID 114991492
2-cyclopropyl-2-(2,4-difluorophenoxy)propanoic acid (PubChem CID 114991492) has the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. Its IUPAC name is 2-cyclopropyl-2-(2,4-difluorophenoxy)propanoic acid.
| Compound Name | 2-cyclopropyl-2-(2,4-difluorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 114991492 |
| Molecular Formula | C12H12F2O3 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-cyclopropyl-2-(2,4-difluorophenoxy)propanoic acid |
| SMILES | CC(Oc1ccc(F)cc1F)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H12F2O3/c1-12(11(15)16,7-2-3-7)17-10-5-4-8(13)6-9(10)14/h4-7H,2-3H2,1H3,(H,15,16) |
| InChIKey | GGKDCNRWIMLCTF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |