C10H19NO3S — CID 114993797
3-[(3-methoxy-2-methylpropyl)amino]thiolane-3-carboxylic acid (PubChem CID 114993797) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 3-[(3-methoxy-2-methylpropyl)amino]thiolane-3-carboxylic acid.
| Compound Name | 3-[(3-methoxy-2-methylpropyl)amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 114993797 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-[(3-methoxy-2-methylpropyl)amino]thiolane-3-carboxylic acid |
| SMILES | COCC(C)CNC1(C(=O)O)CCSC1 |
| InChI | InChI=1S/C10H19NO3S/c1-8(6-14-2)5-11-10(9(12)13)3-4-15-7-10/h8,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | NCODVXVKYGTPRC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |