C10H20N2O2S — CID 115000658
3-[2-(dimethylamino)propylamino]thiolane-3-carboxylic acid (PubChem CID 115000658) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-[2-(dimethylamino)propylamino]thiolane-3-carboxylic acid.
| Compound Name | 3-[2-(dimethylamino)propylamino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 115000658 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-[2-(dimethylamino)propylamino]thiolane-3-carboxylic acid |
| SMILES | CC(CNC1(C(=O)O)CCSC1)N(C)C |
| InChI | InChI=1S/C10H20N2O2S/c1-8(12(2)3)6-11-10(9(13)14)4-5-15-7-10/h8,11H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | XYYSMTFRAXZHDU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |