C9H14O6 — CID 11499516
(3aR,5S,6R,6aR)-6-hydroxy-2,2,5-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid (PubChem CID 11499516) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-6-hydroxy-2,2,5-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid.
| Compound Name | (3aR,5S,6R,6aR)-6-hydroxy-2,2,5-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 11499516 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (3aR,5S,6R,6aR)-6-hydroxy-2,2,5-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6-carboxylic acid |
| SMILES | C[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C9H14O6/c1-4-9(12,7(10)11)5-6(13-4)15-8(2,3)14-5/h4-6,12H,1-3H3,(H,10,11)/t4-,5-,6+,9+/m0/s1 |
| InChIKey | RESDHZZBCCFGPB-OLNRIVSGSA-N |
| XLogP | -0.30 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |