C14H22O11 — CID 139090076
dimethyl (1S,3S,5S,6R,7S,9S,11S,12R)-6,12-dihydroxy-5,11-dimethyl-2,4,8,10-tetraoxatricyclo[7.3.0.03,7]dodecane-6,12-dicarboxylate;hydrate (PubChem CID 139090076) has the molecular formula C14H22O11 and a molecular weight of 366.32 g/mol. Its IUPAC name is dimethyl (1S,3S,5S,6R,7S,9S,11S,12R)-6,12-dihydroxy-5,11-dimethyl-2,4,8,10-tetraoxatricyclo[7.3.0.03,7]dodecane-6,12-dicarboxylate;hydrate.
| Compound Name | dimethyl (1S,3S,5S,6R,7S,9S,11S,12R)-6,12-dihydroxy-5,11-dimethyl-2,4,8,10-tetraoxatricyclo[7.3.0.03,7]dodecane-6,12-dicarboxylate;hydrate |
|---|---|
| PubChem CID | 139090076 |
| Molecular Formula | C14H22O11 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | dimethyl (1S,3S,5S,6R,7S,9S,11S,12R)-6,12-dihydroxy-5,11-dimethyl-2,4,8,10-tetraoxatricyclo[7.3.0.03,7]dodecane-6,12-dicarboxylate;hydrate |
| SMILES | COC(=O)[C@@]1(O)[C@H](C)O[C@H]2O[C@@H]3[C@@H](O[C@@H](C)[C@]3(O)C(=O)OC)O[C@H]21.O |
| InChI | InChI=1S/C14H20O10.H2O/c1-5-13(17,11(15)19-3)7-9(21-5)24-8-10(23-7)22-6(2)14(8,18)12(16)20-4;/h5-10,17-18H,1-4H3;1H2/t5-,6-,7+,8+,9-,10-,13+,14+;/m0./s1 |
| InChIKey | MIFBLNBXJZKIAN-XBFNUXNQSA-N |
| XLogP | -2.76 |
| TPSA | 161.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |