C15H20O12 — CID 159543231
[2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetyl]oxymethyl 2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetate (PubChem CID 159543231) has the molecular formula C15H20O12 and a molecular weight of 392.31 g/mol. Its IUPAC name is [2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetyl]oxymethyl 2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetate.
| Compound Name | [2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetyl]oxymethyl 2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 159543231 |
| Molecular Formula | C15H20O12 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetyl]oxymethyl 2-[4-(1-hydroxyethyl)-5-oxo-1,3-dioxolan-4-yl]acetate |
| SMILES | CC(O)C1(CC(=O)OCOC(=O)CC2(C(C)O)OCOC2=O)OCOC1=O |
| InChI | InChI=1S/C15H20O12/c1-8(16)14(12(20)24-6-26-14)3-10(18)22-5-23-11(19)4-15(9(2)17)13(21)25-7-27-15/h8-9,16-17H,3-7H2,1-2H3 |
| InChIKey | MEMCNDAWKVTQKA-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|