C11H18O8 — CID 57270869
3-(hydroxymethyl)-2,2-dimethoxy-4-oxo-3-propanoyloxypentanoic acid (PubChem CID 57270869) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2,2-dimethoxy-4-oxo-3-propanoyloxypentanoic acid.
| Compound Name | 3-(hydroxymethyl)-2,2-dimethoxy-4-oxo-3-propanoyloxypentanoic acid |
|---|---|
| PubChem CID | 57270869 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-(hydroxymethyl)-2,2-dimethoxy-4-oxo-3-propanoyloxypentanoic acid |
| SMILES | CCC(=O)OC(CO)(C(C)=O)C(OC)(OC)C(=O)O |
| InChI | InChI=1S/C11H18O8/c1-5-8(14)19-10(6-12,7(2)13)11(17-3,18-4)9(15)16/h12H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | RXNFWKAEKYSYKH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|