C10H20N4 — CID 114995509
4-N,2-dimethyl-4-N-pentyl-1H-imidazole-4,5-diamine (PubChem CID 114995509) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 4-N,2-dimethyl-4-N-pentyl-1H-imidazole-4,5-diamine.
| Compound Name | 4-N,2-dimethyl-4-N-pentyl-1H-imidazole-4,5-diamine |
|---|---|
| PubChem CID | 114995509 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 4-N,2-dimethyl-4-N-pentyl-1H-imidazole-4,5-diamine |
| SMILES | CCCCCN(C)c1nc(C)[nH]c1N |
| InChI | InChI=1S/C10H20N4/c1-4-5-6-7-14(3)10-9(11)12-8(2)13-10/h4-7,11H2,1-3H3,(H,12,13) |
| InChIKey | CSHAHUUUVFBGAM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|