C14H20N4 — CID 55011806
4-N-benzyl-2-methyl-4-N-propyl-1H-imidazole-4,5-diamine (PubChem CID 55011806) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-N-benzyl-2-methyl-4-N-propyl-1H-imidazole-4,5-diamine.
| Compound Name | 4-N-benzyl-2-methyl-4-N-propyl-1H-imidazole-4,5-diamine |
|---|---|
| PubChem CID | 55011806 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-N-benzyl-2-methyl-4-N-propyl-1H-imidazole-4,5-diamine |
| SMILES | CCCN(Cc1ccccc1)c1nc(C)[nH]c1N |
| InChI | InChI=1S/C14H20N4/c1-3-9-18(10-12-7-5-4-6-8-12)14-13(15)16-11(2)17-14/h4-8H,3,9-10,15H2,1-2H3,(H,16,17) |
| InChIKey | GJCXFPGHAWSDLY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |