C22H22N4 — CID 153397361
2-[4-amino-6-[benzyl(propyl)amino]-2-pyridinyl]benzonitrile (PubChem CID 153397361) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-[4-amino-6-[benzyl(propyl)amino]-2-pyridinyl]benzonitrile.
| Compound Name | 2-[4-amino-6-[benzyl(propyl)amino]-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 153397361 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-[4-amino-6-[benzyl(propyl)amino]-2-pyridinyl]benzonitrile |
| SMILES | CCCN(Cc1ccccc1)c1cc(N)cc(-c2ccccc2C#N)n1 |
| InChI | InChI=1S/C22H22N4/c1-2-12-26(16-17-8-4-3-5-9-17)22-14-19(24)13-21(25-22)20-11-7-6-10-18(20)15-23/h3-11,13-14H,2,12,16H2,1H3,(H2,24,25) |
| InChIKey | MJETUNHHESYRBO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |