C29H32N5O2Y- — CID 153397341
2-[6-[benzyl(propyl)amino]-4-(hydroxyamino)-2-pyridinyl]benzamide;(4-methylphenyl)azanide;yttrium (PubChem CID 153397341) has the molecular formula C29H32N5O2Y- and a molecular weight of 571.51 g/mol. Its IUPAC name is 2-[6-[benzyl(propyl)amino]-4-(hydroxyamino)-2-pyridinyl]benzamide;(4-methylphenyl)azanide;yttrium.
| Compound Name | 2-[6-[benzyl(propyl)amino]-4-(hydroxyamino)-2-pyridinyl]benzamide;(4-methylphenyl)azanide;yttrium |
|---|---|
| PubChem CID | 153397341 |
| Molecular Formula | C29H32N5O2Y- |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 2-[6-[benzyl(propyl)amino]-4-(hydroxyamino)-2-pyridinyl]benzamide;(4-methylphenyl)azanide;yttrium |
| SMILES | CCCN(Cc1ccccc1)c1cc(NO)cc(-c2ccccc2C(N)=O)n1.Cc1ccc([NH-])cc1.[Y] |
| InChI | InChI=1S/C22H24N4O2.C7H8N.Y/c1-2-12-26(15-16-8-4-3-5-9-16)21-14-17(25-28)13-20(24-21)18-10-6-7-11-19(18)22(23)27;1-6-2-4-7(8)5-3-6;/h3-11,13-14,28H,2,12,15H2,1H3,(H2,23,27)(H,24,25);2-5,8H,1H3;/q;-1; |
| InChIKey | XKLOEFZPQACXFQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|