C34H36N4O2S — CID 146320680
2-[6-[benzyl(propyl)amino]-4-[[2-(4-methylphenyl)acetyl]amino]-2-pyridinyl]-N-cyclopropylsulfanylbenzamide (PubChem CID 146320680) has the molecular formula C34H36N4O2S and a molecular weight of 564.76 g/mol. Its IUPAC name is 2-[6-[benzyl(propyl)amino]-4-[[2-(4-methylphenyl)acetyl]amino]-2-pyridinyl]-N-cyclopropylsulfanylbenzamide.
| Compound Name | 2-[6-[benzyl(propyl)amino]-4-[[2-(4-methylphenyl)acetyl]amino]-2-pyridinyl]-N-cyclopropylsulfanylbenzamide |
|---|---|
| PubChem CID | 146320680 |
| Molecular Formula | C34H36N4O2S |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 2-[6-[benzyl(propyl)amino]-4-[[2-(4-methylphenyl)acetyl]amino]-2-pyridinyl]-N-cyclopropylsulfanylbenzamide |
| SMILES | CCCN(Cc1ccccc1)c1cc(NC(=O)Cc2ccc(C)cc2)cc(-c2ccccc2C(=O)NSC2CC2)n1 |
| InChI | InChI=1S/C34H36N4O2S/c1-3-19-38(23-26-9-5-4-6-10-26)32-22-27(35-33(39)20-25-15-13-24(2)14-16-25)21-31(36-32)29-11-7-8-12-30(29)34(40)37-41-28-17-18-28/h4-16,21-22,28H,3,17-20,23H2,1-2H3,(H,37,40)(H,35,36,39) |
| InChIKey | CGBHHLFUNFLRRV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|