C32H36N8O — CID 146320746
1-[2-[2-(N-hydrazinylidenecarbamimidoyl)-5-methylphenyl]-6-[2-phenylethyl(propyl)amino]-4-pyridinyl]-3-(4-methylphenyl)urea (PubChem CID 146320746) has the molecular formula C32H36N8O and a molecular weight of 548.70 g/mol. Its IUPAC name is 1-[2-[2-(N-hydrazinylidenecarbamimidoyl)-5-methylphenyl]-6-[2-phenylethyl(propyl)amino]-4-pyridinyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[2-[2-(N-hydrazinylidenecarbamimidoyl)-5-methylphenyl]-6-[2-phenylethyl(propyl)amino]-4-pyridinyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 146320746 |
| Molecular Formula | C32H36N8O |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | 1-[2-[2-(N-hydrazinylidenecarbamimidoyl)-5-methylphenyl]-6-[2-phenylethyl(propyl)amino]-4-pyridinyl]-3-(4-methylphenyl)urea |
| SMILES | [H]/N=C(\N=N\N)c1ccc(C)cc1-c1cc(NC(=O)Nc2ccc(C)cc2)cc(N(CCC)CCc2ccccc2)n1 |
| InChI | InChI=1S/C32H36N8O/c1-4-17-40(18-16-24-8-6-5-7-9-24)30-21-26(36-32(41)35-25-13-10-22(2)11-14-25)20-29(37-30)28-19-23(3)12-15-27(28)31(33)38-39-34/h5-15,19-21H,4,16-18H2,1-3H3,(H3,33,34,38)(H2,35,36,37,41) |
| InChIKey | VJSMRUBDDSDAGT-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|