C11H11ClN4 — CID 114999612
3-chloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine (PubChem CID 114999612) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is 3-chloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-chloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 114999612 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-chloro-N-(3,5-dimethylphenyl)-1,2,4-triazin-5-amine |
| SMILES | Cc1cc(C)cc(Nc2cnnc(Cl)n2)c1 |
| InChI | InChI=1S/C11H11ClN4/c1-7-3-8(2)5-9(4-7)14-10-6-13-16-11(12)15-10/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | CZUATEZZYUGTMX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |